C11H13N7O2S — CID 62250630
[4-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]-2-nitrophenyl]hydrazine (PubChem CID 62250630) has the molecular formula C11H13N7O2S and a molecular weight of 307.34 g/mol. Its IUPAC name is [4-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]-2-nitrophenyl]hydrazine.
| Compound Name | [4-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]-2-nitrophenyl]hydrazine |
|---|---|
| PubChem CID | 62250630 |
| Molecular Formula | C11H13N7O2S |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | [4-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]-2-nitrophenyl]hydrazine |
| SMILES | NNc1ccc(CSc2nnnn2C2CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13N7O2S/c12-13-9-4-1-7(5-10(9)18(19)20)6-21-11-14-15-16-17(11)8-2-3-8/h1,4-5,8,13H,2-3,6,12H2 |
| InChIKey | BDALNLRDDGXCAL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|