C18H18N4O2S2 — CID 39536267
1-cyclopropyl-5-[[4-(4-methylphenyl)sulfonylphenyl]methylsulfanyl]tetrazole (PubChem CID 39536267) has the molecular formula C18H18N4O2S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 1-cyclopropyl-5-[[4-(4-methylphenyl)sulfonylphenyl]methylsulfanyl]tetrazole.
| Compound Name | 1-cyclopropyl-5-[[4-(4-methylphenyl)sulfonylphenyl]methylsulfanyl]tetrazole |
|---|---|
| PubChem CID | 39536267 |
| Molecular Formula | C18H18N4O2S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 1-cyclopropyl-5-[[4-(4-methylphenyl)sulfonylphenyl]methylsulfanyl]tetrazole |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(CSc3nnnn3C3CC3)cc2)cc1 |
| InChI | InChI=1S/C18H18N4O2S2/c1-13-2-8-16(9-3-13)26(23,24)17-10-4-14(5-11-17)12-25-18-19-20-21-22(18)15-6-7-15/h2-5,8-11,15H,6-7,12H2,1H3 |
| InChIKey | JCSLDFIDCCROCP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |