C13H14N4O2S — CID 26388915
methyl 4-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]benzoate (PubChem CID 26388915) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is methyl 4-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]benzoate.
| Compound Name | methyl 4-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 26388915 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | methyl 4-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CSc2nnnn2C2CC2)cc1 |
| InChI | InChI=1S/C13H14N4O2S/c1-19-12(18)10-4-2-9(3-5-10)8-20-13-14-15-16-17(13)11-6-7-11/h2-5,11H,6-8H2,1H3 |
| InChIKey | LUYAYDHLHBQQQH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |