C21H20N2O2S — CID 18267471
methyl 4-[(1-cyclopropyl-5-phenylimidazol-2-yl)sulfanylmethyl]benzoate (PubChem CID 18267471) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is methyl 4-[(1-cyclopropyl-5-phenylimidazol-2-yl)sulfanylmethyl]benzoate.
| Compound Name | methyl 4-[(1-cyclopropyl-5-phenylimidazol-2-yl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 18267471 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | methyl 4-[(1-cyclopropyl-5-phenylimidazol-2-yl)sulfanylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CSc2ncc(-c3ccccc3)n2C2CC2)cc1 |
| InChI | InChI=1S/C21H20N2O2S/c1-25-20(24)17-9-7-15(8-10-17)14-26-21-22-13-19(23(21)18-11-12-18)16-5-3-2-4-6-16/h2-10,13,18H,11-12,14H2,1H3 |
| InChIKey | OITRIIQACDQDSA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |