C22H22N2O2S — CID 18275943
1-[3-[(1-cyclopropyl-5-phenylimidazol-2-yl)sulfanylmethyl]-4-methoxyphenyl]ethanone (PubChem CID 18275943) has the molecular formula C22H22N2O2S and a molecular weight of 378.50 g/mol. Its IUPAC name is 1-[3-[(1-cyclopropyl-5-phenylimidazol-2-yl)sulfanylmethyl]-4-methoxyphenyl]ethanone.
| Compound Name | 1-[3-[(1-cyclopropyl-5-phenylimidazol-2-yl)sulfanylmethyl]-4-methoxyphenyl]ethanone |
|---|---|
| PubChem CID | 18275943 |
| Molecular Formula | C22H22N2O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 1-[3-[(1-cyclopropyl-5-phenylimidazol-2-yl)sulfanylmethyl]-4-methoxyphenyl]ethanone |
| SMILES | COc1ccc(C(C)=O)cc1CSc1ncc(-c2ccccc2)n1C1CC1 |
| InChI | InChI=1S/C22H22N2O2S/c1-15(25)17-8-11-21(26-2)18(12-17)14-27-22-23-13-20(24(22)19-9-10-19)16-6-4-3-5-7-16/h3-8,11-13,19H,9-10,14H2,1-2H3 |
| InChIKey | VQMNYFVHCWKNKX-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |