C24H26N2O3S — CID 46694675
1-[4-methoxy-3-[[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylmethyl]phenyl]ethanone (PubChem CID 46694675) has the molecular formula C24H26N2O3S and a molecular weight of 422.55 g/mol. Its IUPAC name is 1-[4-methoxy-3-[[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylmethyl]phenyl]ethanone.
| Compound Name | 1-[4-methoxy-3-[[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylmethyl]phenyl]ethanone |
|---|---|
| PubChem CID | 46694675 |
| Molecular Formula | C24H26N2O3S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 1-[4-methoxy-3-[[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylmethyl]phenyl]ethanone |
| SMILES | COc1ccc(C(C)=O)cc1CSc1ncc(-c2ccccc2)n1CC1CCCO1 |
| InChI | InChI=1S/C24H26N2O3S/c1-17(27)19-10-11-23(28-2)20(13-19)16-30-24-25-14-22(18-7-4-3-5-8-18)26(24)15-21-9-6-12-29-21/h3-5,7-8,10-11,13-14,21H,6,9,12,15-16H2,1-2H3 |
| InChIKey | IEKRYWAQFYUZDG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|