C26H29N3O4S — CID 3168738
ethyl 2-(N-[2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylacetyl]anilino)acetate (PubChem CID 3168738) has the molecular formula C26H29N3O4S and a molecular weight of 479.60 g/mol. Its IUPAC name is ethyl 2-(N-[2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylacetyl]anilino)acetate.
| Compound Name | ethyl 2-(N-[2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylacetyl]anilino)acetate |
|---|---|
| PubChem CID | 3168738 |
| Molecular Formula | C26H29N3O4S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | ethyl 2-(N-[2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylacetyl]anilino)acetate |
| SMILES | CCOC(=O)CN(C(=O)CSc1ncc(-c2ccccc2)n1CC1CCCO1)c1ccccc1 |
| InChI | InChI=1S/C26H29N3O4S/c1-2-32-25(31)18-28(21-12-7-4-8-13-21)24(30)19-34-26-27-16-23(20-10-5-3-6-11-20)29(26)17-22-14-9-15-33-22/h3-8,10-13,16,22H,2,9,14-15,17-19H2,1H3 |
| InChIKey | NXIAAIKSUYXHMF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|