C23H31N3O4S2 — CID 24591698
N-(1,1-dioxothiolan-3-yl)-2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanyl-N-propylacetamide (PubChem CID 24591698) has the molecular formula C23H31N3O4S2 and a molecular weight of 477.65 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanyl-N-propylacetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanyl-N-propylacetamide |
|---|---|
| PubChem CID | 24591698 |
| Molecular Formula | C23H31N3O4S2 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanyl-N-propylacetamide |
| SMILES | CCCN(C(=O)CSc1ncc(-c2ccccc2)n1CC1CCCO1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C23H31N3O4S2/c1-2-11-25(19-10-13-32(28,29)17-19)22(27)16-31-23-24-14-21(18-7-4-3-5-8-18)26(23)15-20-9-6-12-30-20/h3-5,7-8,14,19-20H,2,6,9-13,15-17H2,1H3 |
| InChIKey | VEQOUGFIMWFRBT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|