C19H24N2O2S — CID 94578664
1-[[(2S)-oxolan-2-yl]methyl]-2-[[(2S)-oxolan-2-yl]methylsulfanyl]-5-phenylimidazole (PubChem CID 94578664) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is 1-[[(2S)-oxolan-2-yl]methyl]-2-[[(2S)-oxolan-2-yl]methylsulfanyl]-5-phenylimidazole.
| Compound Name | 1-[[(2S)-oxolan-2-yl]methyl]-2-[[(2S)-oxolan-2-yl]methylsulfanyl]-5-phenylimidazole |
|---|---|
| PubChem CID | 94578664 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 1-[[(2S)-oxolan-2-yl]methyl]-2-[[(2S)-oxolan-2-yl]methylsulfanyl]-5-phenylimidazole |
| SMILES | c1ccc(-c2cnc(SC[C@@H]3CCCO3)n2C[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C19H24N2O2S/c1-2-6-15(7-3-1)18-12-20-19(24-14-17-9-5-11-23-17)21(18)13-16-8-4-10-22-16/h1-3,6-7,12,16-17H,4-5,8-11,13-14H2/t16-,17-/m0/s1 |
| InChIKey | KSGKQZFUZYVEAW-IRXDYDNUSA-N |
| XLogP | 4.00 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|