C20H26N6OS — CID 138038844
1-tert-butyl-5-[[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylmethyl]tetrazole (PubChem CID 138038844) has the molecular formula C20H26N6OS and a molecular weight of 398.54 g/mol. Its IUPAC name is 1-tert-butyl-5-[[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylmethyl]tetrazole.
| Compound Name | 1-tert-butyl-5-[[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylmethyl]tetrazole |
|---|---|
| PubChem CID | 138038844 |
| Molecular Formula | C20H26N6OS |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 1-tert-butyl-5-[[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylmethyl]tetrazole |
| SMILES | CC(C)(C)n1nnnc1CSc1ncc(-c2ccccc2)n1CC1CCCO1 |
| InChI | InChI=1S/C20H26N6OS/c1-20(2,3)26-18(22-23-24-26)14-28-19-21-12-17(15-8-5-4-6-9-15)25(19)13-16-10-7-11-27-16/h4-6,8-9,12,16H,7,10-11,13-14H2,1-3H3 |
| InChIKey | MBWCIZKEDNPURD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|