C21H26N4O2S — CID 35364425
5-tert-butyl-3-[[1-[[(2S)-oxolan-2-yl]methyl]-5-phenylimidazol-2-yl]sulfanylmethyl]-1,2,4-oxadiazole (PubChem CID 35364425) has the molecular formula C21H26N4O2S and a molecular weight of 398.53 g/mol. Its IUPAC name is 5-tert-butyl-3-[[1-[[(2S)-oxolan-2-yl]methyl]-5-phenylimidazol-2-yl]sulfanylmethyl]-1,2,4-oxadiazole.
| Compound Name | 5-tert-butyl-3-[[1-[[(2S)-oxolan-2-yl]methyl]-5-phenylimidazol-2-yl]sulfanylmethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 35364425 |
| Molecular Formula | C21H26N4O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 5-tert-butyl-3-[[1-[[(2S)-oxolan-2-yl]methyl]-5-phenylimidazol-2-yl]sulfanylmethyl]-1,2,4-oxadiazole |
| SMILES | CC(C)(C)c1nc(CSc2ncc(-c3ccccc3)n2C[C@@H]2CCCO2)no1 |
| InChI | InChI=1S/C21H26N4O2S/c1-21(2,3)19-23-18(24-27-19)14-28-20-22-12-17(15-8-5-4-6-9-15)25(20)13-16-10-7-11-26-16/h4-6,8-9,12,16H,7,10-11,13-14H2,1-3H3/t16-/m0/s1 |
| InChIKey | RIJYHYSLHPBVAB-INIZCTEOSA-N |
| XLogP | 4.70 |
| TPSA | 65.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|