C19H25N3O2S — CID 17440346
2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanyl-N-propylacetamide (PubChem CID 17440346) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is 2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanyl-N-propylacetamide.
| Compound Name | 2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanyl-N-propylacetamide |
|---|---|
| PubChem CID | 17440346 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanyl-N-propylacetamide |
| SMILES | CCCNC(=O)CSc1ncc(-c2ccccc2)n1CC1CCCO1 |
| InChI | InChI=1S/C19H25N3O2S/c1-2-10-20-18(23)14-25-19-21-12-17(15-7-4-3-5-8-15)22(19)13-16-9-6-11-24-16/h3-5,7-8,12,16H,2,6,9-11,13-14H2,1H3,(H,20,23) |
| InChIKey | GYGBQIFPIYLRGM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|