C19H25N3O2S — CID 40790824
(2R)-N-ethyl-2-[1-[[(2S)-oxolan-2-yl]methyl]-5-phenylimidazol-2-yl]sulfanylpropanamide (PubChem CID 40790824) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is (2R)-N-ethyl-2-[1-[[(2S)-oxolan-2-yl]methyl]-5-phenylimidazol-2-yl]sulfanylpropanamide.
| Compound Name | (2R)-N-ethyl-2-[1-[[(2S)-oxolan-2-yl]methyl]-5-phenylimidazol-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 40790824 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | (2R)-N-ethyl-2-[1-[[(2S)-oxolan-2-yl]methyl]-5-phenylimidazol-2-yl]sulfanylpropanamide |
| SMILES | CCNC(=O)[C@@H](C)Sc1ncc(-c2ccccc2)n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C19H25N3O2S/c1-3-20-18(23)14(2)25-19-21-12-17(15-8-5-4-6-9-15)22(19)13-16-10-7-11-24-16/h4-6,8-9,12,14,16H,3,7,10-11,13H2,1-2H3,(H,20,23)/t14-,16+/m1/s1 |
| InChIKey | QJNPVBLCHHFWDJ-ZBFHGGJFSA-N |
| XLogP | 3.35 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |