C23H25N3O2S — CID 24591682
2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanyl-N-phenylpropanamide (PubChem CID 24591682) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is 2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanyl-N-phenylpropanamide.
| Compound Name | 2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanyl-N-phenylpropanamide |
|---|---|
| PubChem CID | 24591682 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanyl-N-phenylpropanamide |
| SMILES | CC(Sc1ncc(-c2ccccc2)n1CC1CCCO1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C23H25N3O2S/c1-17(22(27)25-19-11-6-3-7-12-19)29-23-24-15-21(18-9-4-2-5-10-18)26(23)16-20-13-8-14-28-20/h2-7,9-12,15,17,20H,8,13-14,16H2,1H3,(H,25,27) |
| InChIKey | RIZDLJFCLBYWJY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |