C25H27N3O2S — CID 24591748
N-cyclopropyl-2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanyl-2-phenylacetamide (PubChem CID 24591748) has the molecular formula C25H27N3O2S and a molecular weight of 433.58 g/mol. Its IUPAC name is N-cyclopropyl-2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanyl-2-phenylacetamide.
| Compound Name | N-cyclopropyl-2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanyl-2-phenylacetamide |
|---|---|
| PubChem CID | 24591748 |
| Molecular Formula | C25H27N3O2S |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | N-cyclopropyl-2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanyl-2-phenylacetamide |
| SMILES | O=C(NC1CC1)C(Sc1ncc(-c2ccccc2)n1CC1CCCO1)c1ccccc1 |
| InChI | InChI=1S/C25H27N3O2S/c29-24(27-20-13-14-20)23(19-10-5-2-6-11-19)31-25-26-16-22(18-8-3-1-4-9-18)28(25)17-21-12-7-15-30-21/h1-6,8-11,16,20-21,23H,7,12-15,17H2,(H,27,29) |
| InChIKey | BWZHSJKICIWGAC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |