C27H29N5O2S — CID 24591709
N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylacetamide (PubChem CID 24591709) has the molecular formula C27H29N5O2S and a molecular weight of 487.63 g/mol. Its IUPAC name is N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylacetamide.
| Compound Name | N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 24591709 |
| Molecular Formula | C27H29N5O2S |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylacetamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1NC(=O)CSc1ncc(-c2ccccc2)n1CC1CCCO1 |
| InChI | InChI=1S/C27H29N5O2S/c1-19-26(20(2)32(30-19)22-12-7-4-8-13-22)29-25(33)18-35-27-28-16-24(21-10-5-3-6-11-21)31(27)17-23-14-9-15-34-23/h3-8,10-13,16,23H,9,14-15,17-18H2,1-2H3,(H,29,33) |
| InChIKey | AVMMLVLZRMSGPE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|