C22H21ClFN3O2S — CID 46688500
N-(5-chloro-2-fluorophenyl)-2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylacetamide (PubChem CID 46688500) has the molecular formula C22H21ClFN3O2S and a molecular weight of 445.95 g/mol. Its IUPAC name is N-(5-chloro-2-fluorophenyl)-2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylacetamide.
| Compound Name | N-(5-chloro-2-fluorophenyl)-2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 46688500 |
| Molecular Formula | C22H21ClFN3O2S |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | N-(5-chloro-2-fluorophenyl)-2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylacetamide |
| SMILES | O=C(CSc1ncc(-c2ccccc2)n1CC1CCCO1)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C22H21ClFN3O2S/c23-16-8-9-18(24)19(11-16)26-21(28)14-30-22-25-12-20(15-5-2-1-3-6-15)27(22)13-17-7-4-10-29-17/h1-3,5-6,8-9,11-12,17H,4,7,10,13-14H2,(H,26,28) |
| InChIKey | FBPOILGQPZMIIS-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|