C25H27ClN4O3S — CID 24591710
N-(2-chlorophenyl)-2-[methyl-[2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylacetyl]amino]acetamide (PubChem CID 24591710) has the molecular formula C25H27ClN4O3S and a molecular weight of 499.04 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[methyl-[2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylacetyl]amino]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[methyl-[2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylacetyl]amino]acetamide |
|---|---|
| PubChem CID | 24591710 |
| Molecular Formula | C25H27ClN4O3S |
| Molecular Weight | 499.04 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | N-(2-chlorophenyl)-2-[methyl-[2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylacetyl]amino]acetamide |
| SMILES | CN(CC(=O)Nc1ccccc1Cl)C(=O)CSc1ncc(-c2ccccc2)n1CC1CCCO1 |
| InChI | InChI=1S/C25H27ClN4O3S/c1-29(16-23(31)28-21-12-6-5-11-20(21)26)24(32)17-34-25-27-14-22(18-8-3-2-4-9-18)30(25)15-19-10-7-13-33-19/h2-6,8-9,11-12,14,19H,7,10,13,15-17H2,1H3,(H,28,31) |
| InChIKey | IFTSNQGOIHIHHK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.04 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|