C24H24N4O2S — CID 42933006
9-methyl-2-[[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylmethyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 42933006) has the molecular formula C24H24N4O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is 9-methyl-2-[[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylmethyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 9-methyl-2-[[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylmethyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 42933006 |
| Molecular Formula | C24H24N4O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 9-methyl-2-[[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylmethyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1cccn2c(=O)cc(CSc3ncc(-c4ccccc4)n3CC3CCCO3)nc12 |
| InChI | InChI=1S/C24H24N4O2S/c1-17-7-5-11-27-22(29)13-19(26-23(17)27)16-31-24-25-14-21(18-8-3-2-4-9-18)28(24)15-20-10-6-12-30-20/h2-5,7-9,11,13-14,20H,6,10,12,15-16H2,1H3 |
| InChIKey | RALWIXLZFJEFRV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|