C16H18N6OS — CID 138038590
5-[[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylmethyl]-2H-tetrazole (PubChem CID 138038590) has the molecular formula C16H18N6OS and a molecular weight of 342.43 g/mol. Its IUPAC name is 5-[[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylmethyl]-2H-tetrazole.
| Compound Name | 5-[[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylmethyl]-2H-tetrazole |
|---|---|
| PubChem CID | 138038590 |
| Molecular Formula | C16H18N6OS |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 5-[[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylmethyl]-2H-tetrazole |
| SMILES | c1ccc(-c2cnc(SCc3nn[nH]n3)n2CC2CCCO2)cc1 |
| InChI | InChI=1S/C16H18N6OS/c1-2-5-12(6-3-1)14-9-17-16(24-11-15-18-20-21-19-15)22(14)10-13-7-4-8-23-13/h1-3,5-6,9,13H,4,7-8,10-11H2,(H,18,19,20,21) |
| InChIKey | MVGAZPAJRJYTTA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|