C24H25N3O2S — CID 55485838
1-(2,3-dihydroindol-1-yl)-2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylethanone (PubChem CID 55485838) has the molecular formula C24H25N3O2S and a molecular weight of 419.55 g/mol. Its IUPAC name is 1-(2,3-dihydroindol-1-yl)-2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylethanone.
| Compound Name | 1-(2,3-dihydroindol-1-yl)-2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylethanone |
|---|---|
| PubChem CID | 55485838 |
| Molecular Formula | C24H25N3O2S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 1-(2,3-dihydroindol-1-yl)-2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylethanone |
| SMILES | O=C(CSc1ncc(-c2ccccc2)n1CC1CCCO1)N1CCc2ccccc21 |
| InChI | InChI=1S/C24H25N3O2S/c28-23(26-13-12-19-9-4-5-11-21(19)26)17-30-24-25-15-22(18-7-2-1-3-8-18)27(24)16-20-10-6-14-29-20/h1-5,7-9,11,15,20H,6,10,12-14,16-17H2 |
| InChIKey | KRXQSGKDLZFBLA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|