C24H19N3O2S — CID 6408885
methyl 4-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanylmethyl]benzoate (PubChem CID 6408885) has the molecular formula C24H19N3O2S and a molecular weight of 413.50 g/mol. Its IUPAC name is methyl 4-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanylmethyl]benzoate.
| Compound Name | methyl 4-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 6408885 |
| Molecular Formula | C24H19N3O2S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | methyl 4-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CSc2nnc(-c3ccccc3)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H19N3O2S/c1-29-23(28)20-14-12-17(13-15-20)16-30-24-25-21(18-8-4-2-5-9-18)22(26-27-24)19-10-6-3-7-11-19/h2-15H,16H2,1H3 |
| InChIKey | FOYIKFJKKVJKKS-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |