C18H14N4O2S — CID 5292677
methyl 4-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanylmethyl)benzoate (PubChem CID 5292677) has the molecular formula C18H14N4O2S and a molecular weight of 350.40 g/mol. Its IUPAC name is methyl 4-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanylmethyl)benzoate.
| Compound Name | methyl 4-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanylmethyl)benzoate |
|---|---|
| PubChem CID | 5292677 |
| Molecular Formula | C18H14N4O2S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | methyl 4-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanylmethyl)benzoate |
| SMILES | COC(=O)c1ccc(CSc2nnc3c(n2)[nH]c2ccccc23)cc1 |
| InChI | InChI=1S/C18H14N4O2S/c1-24-17(23)12-8-6-11(7-9-12)10-25-18-20-16-15(21-22-18)13-4-2-3-5-14(13)19-16/h2-9H,10H2,1H3,(H,19,20,22) |
| InChIKey | KXWVTMMCWKUNBV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |