C15H10N4O2S — CID 17308902
1-(furan-2-yl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)ethanone (PubChem CID 17308902) has the molecular formula C15H10N4O2S and a molecular weight of 310.34 g/mol. Its IUPAC name is 1-(furan-2-yl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)ethanone.
| Compound Name | 1-(furan-2-yl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)ethanone |
|---|---|
| PubChem CID | 17308902 |
| Molecular Formula | C15H10N4O2S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 1-(furan-2-yl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)ethanone |
| SMILES | O=C(CSc1nnc2c(n1)[nH]c1ccccc12)c1ccco1 |
| InChI | InChI=1S/C15H10N4O2S/c20-11(12-6-3-7-21-12)8-22-15-17-14-13(18-19-15)9-4-1-2-5-10(9)16-14/h1-7H,8H2,(H,16,17,19) |
| InChIKey | NIBHVLWAJFAGIO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_656b(3)', 'substructure': 'N/A'} |
|---|