C14H10N6O3S — CID 6414637
1-(4-methyl-2-oxido-1,2,5-oxadiazol-2-ium-3-yl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)ethanone (PubChem CID 6414637) has the molecular formula C14H10N6O3S and a molecular weight of 342.34 g/mol. Its IUPAC name is 1-(4-methyl-2-oxido-1,2,5-oxadiazol-2-ium-3-yl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)ethanone.
| Compound Name | 1-(4-methyl-2-oxido-1,2,5-oxadiazol-2-ium-3-yl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)ethanone |
|---|---|
| PubChem CID | 6414637 |
| Molecular Formula | C14H10N6O3S |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 1-(4-methyl-2-oxido-1,2,5-oxadiazol-2-ium-3-yl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)ethanone |
| SMILES | Cc1no[n+]([O-])c1C(=O)CSc1nnc2c(n1)[nH]c1ccccc12 |
| InChI | InChI=1S/C14H10N6O3S/c1-7-12(20(22)23-19-7)10(21)6-24-14-16-13-11(17-18-14)8-4-2-3-5-9(8)15-13/h2-5H,6H2,1H3,(H,15,16,18) |
| InChIKey | BRHNLIVYHWYPHM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 124.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_thio_656b(3)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|