C19H12N6O3S — CID 53290930
3-phenyl-4-[2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)acetyl]oxadiazol-3-ium-5-olate (PubChem CID 53290930) has the molecular formula C19H12N6O3S and a molecular weight of 404.41 g/mol. Its IUPAC name is 3-phenyl-4-[2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)acetyl]oxadiazol-3-ium-5-olate.
| Compound Name | 3-phenyl-4-[2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)acetyl]oxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53290930 |
| Molecular Formula | C19H12N6O3S |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 3-phenyl-4-[2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)acetyl]oxadiazol-3-ium-5-olate |
| SMILES | O=C(CSc1nnc2c(n1)[nH]c1ccccc12)c1c([O-])on[n+]1-c1ccccc1 |
| InChI | InChI=1S/C19H12N6O3S/c26-14(16-18(27)28-24-25(16)11-6-2-1-3-7-11)10-29-19-21-17-15(22-23-19)12-8-4-5-9-13(12)20-17/h1-9H,10H2,(H-,20,21,22,23,24,26,27) |
| InChIKey | JHPYCGANCQBEGC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 124.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_thio_656b(3)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|