C18H21N5OS — CID 6404345
1-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)ethanone (PubChem CID 6404345) has the molecular formula C18H21N5OS and a molecular weight of 355.47 g/mol. Its IUPAC name is 1-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)ethanone.
| Compound Name | 1-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)ethanone |
|---|---|
| PubChem CID | 6404345 |
| Molecular Formula | C18H21N5OS |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 1-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)ethanone |
| SMILES | C[C@@H]1CCC[C@H](C)N1C(=O)CSc1nnc2c(n1)[nH]c1ccccc12 |
| InChI | InChI=1S/C18H21N5OS/c1-11-6-5-7-12(2)23(11)15(24)10-25-18-20-17-16(21-22-18)13-8-3-4-9-14(13)19-17/h3-4,8-9,11-12H,5-7,10H2,1-2H3,(H,19,20,22)/t11-,12+ |
| InChIKey | CVFDLBYQAFGNRU-TXEJJXNPSA-N |
| XLogP | 3.39 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |