C15H16N4OS — CID 6414090
3,3-dimethyl-1-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)butan-2-one (PubChem CID 6414090) has the molecular formula C15H16N4OS and a molecular weight of 300.39 g/mol. Its IUPAC name is 3,3-dimethyl-1-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)butan-2-one.
| Compound Name | 3,3-dimethyl-1-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)butan-2-one |
|---|---|
| PubChem CID | 6414090 |
| Molecular Formula | C15H16N4OS |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 3,3-dimethyl-1-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)butan-2-one |
| SMILES | CC(C)(C)C(=O)CSc1nnc2c(n1)[nH]c1ccccc12 |
| InChI | InChI=1S/C15H16N4OS/c1-15(2,3)11(20)8-21-14-17-13-12(18-19-14)9-6-4-5-7-10(9)16-13/h4-7H,8H2,1-3H3,(H,16,17,19) |
| InChIKey | GEXUZWVWAMSNMG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_656b(3)', 'substructure': 'N/A'} |
|---|