C18H21N5OS — CID 6409102
N-cycloheptyl-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)acetamide (PubChem CID 6409102) has the molecular formula C18H21N5OS and a molecular weight of 355.47 g/mol. Its IUPAC name is N-cycloheptyl-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)acetamide.
| Compound Name | N-cycloheptyl-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 6409102 |
| Molecular Formula | C18H21N5OS |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-cycloheptyl-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1nnc2c(n1)[nH]c1ccccc12)NC1CCCCCC1 |
| InChI | InChI=1S/C18H21N5OS/c24-15(19-12-7-3-1-2-4-8-12)11-25-18-21-17-16(22-23-18)13-9-5-6-10-14(13)20-17/h5-6,9-10,12H,1-4,7-8,11H2,(H,19,24)(H,20,21,23) |
| InChIKey | FJXACBINBXODJG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |