C17H11N5O3S — CID 6402907
1-(4-nitrophenyl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)ethanone (PubChem CID 6402907) has the molecular formula C17H11N5O3S and a molecular weight of 365.37 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)ethanone.
| Compound Name | 1-(4-nitrophenyl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)ethanone |
|---|---|
| PubChem CID | 6402907 |
| Molecular Formula | C17H11N5O3S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 1-(4-nitrophenyl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)ethanone |
| SMILES | O=C(CSc1nnc2c(n1)[nH]c1ccccc12)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H11N5O3S/c23-14(10-5-7-11(8-6-10)22(24)25)9-26-17-19-16-15(20-21-17)12-3-1-2-4-13(12)18-16/h1-8H,9H2,(H,18,19,21) |
| InChIKey | CCJJAPATGWUTGH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_656b(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|