C13H10N8O2S — CID 5294688
N-(4-amino-1,2,5-oxadiazol-3-yl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)acetamide (PubChem CID 5294688) has the molecular formula C13H10N8O2S and a molecular weight of 342.34 g/mol. Its IUPAC name is N-(4-amino-1,2,5-oxadiazol-3-yl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)acetamide.
| Compound Name | N-(4-amino-1,2,5-oxadiazol-3-yl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 5294688 |
| Molecular Formula | C13H10N8O2S |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | N-(4-amino-1,2,5-oxadiazol-3-yl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)acetamide |
| SMILES | Nc1nonc1NC(=O)CSc1nnc2c(n1)[nH]c1ccccc12 |
| InChI | InChI=1S/C13H10N8O2S/c14-10-12(21-23-20-10)16-8(22)5-24-13-17-11-9(18-19-13)6-3-1-2-4-7(6)15-11/h1-4H,5H2,(H2,14,20)(H,15,17,19)(H,16,21,22) |
| InChIKey | VLSOUSBGVMEQPO-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 148.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |