C25H15N5O3S — CID 6415404
N-(9,10-dioxoanthracen-1-yl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)acetamide (PubChem CID 6415404) has the molecular formula C25H15N5O3S and a molecular weight of 465.49 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-1-yl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)acetamide.
| Compound Name | N-(9,10-dioxoanthracen-1-yl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 6415404 |
| Molecular Formula | C25H15N5O3S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | N-(9,10-dioxoanthracen-1-yl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1nnc2c(n1)[nH]c1ccccc12)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C25H15N5O3S/c31-19(12-34-25-28-24-21(29-30-25)15-8-3-4-10-17(15)27-24)26-18-11-5-9-16-20(18)23(33)14-7-2-1-6-13(14)22(16)32/h1-11H,12H2,(H,26,31)(H,27,28,30) |
| InChIKey | IETOCVBUWSXOCT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|