C18H21N5O2S — CID 1329086
1-[4-[(1-cyclohexyltetrazol-5-yl)sulfanylmethyl]phenyl]pyrrolidine-2,5-dione (PubChem CID 1329086) has the molecular formula C18H21N5O2S and a molecular weight of 371.47 g/mol. Its IUPAC name is 1-[4-[(1-cyclohexyltetrazol-5-yl)sulfanylmethyl]phenyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[4-[(1-cyclohexyltetrazol-5-yl)sulfanylmethyl]phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1329086 |
| Molecular Formula | C18H21N5O2S |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 1-[4-[(1-cyclohexyltetrazol-5-yl)sulfanylmethyl]phenyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1c1ccc(CSc2nnnn2C2CCCCC2)cc1 |
| InChI | InChI=1S/C18H21N5O2S/c24-16-10-11-17(25)22(16)14-8-6-13(7-9-14)12-26-18-19-20-21-23(18)15-4-2-1-3-5-15/h6-9,15H,1-5,10-12H2 |
| InChIKey | CRPVEYJDZFFWTM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|