C14H15F3N4S — CID 52520611
1-cyclopentyl-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]tetrazole (PubChem CID 52520611) has the molecular formula C14H15F3N4S and a molecular weight of 328.36 g/mol. Its IUPAC name is 1-cyclopentyl-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]tetrazole.
| Compound Name | 1-cyclopentyl-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]tetrazole |
|---|---|
| PubChem CID | 52520611 |
| Molecular Formula | C14H15F3N4S |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 1-cyclopentyl-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]tetrazole |
| SMILES | FC(F)(F)c1cccc(CSc2nnnn2C2CCCC2)c1 |
| InChI | InChI=1S/C14H15F3N4S/c15-14(16,17)11-5-3-4-10(8-11)9-22-13-18-19-20-21(13)12-6-1-2-7-12/h3-5,8,12H,1-2,6-7,9H2 |
| InChIKey | DFESMGUMPHEVQC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |