C14H14N4O2S — CID 76908959
3-[3-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]phenyl]prop-2-enoic acid (PubChem CID 76908959) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is 3-[3-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76908959 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 3-[3-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cccc(CSc2nnnn2C2CC2)c1 |
| InChI | InChI=1S/C14H14N4O2S/c19-13(20)7-4-10-2-1-3-11(8-10)9-21-14-15-16-17-18(14)12-5-6-12/h1-4,7-8,12H,5-6,9H2,(H,19,20) |
| InChIKey | RFRZNXDDJVJUFE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|