C14H14N4O2S — CID 76908900
3-[3-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]phenyl]prop-2-enoic acid (PubChem CID 76908900) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is 3-[3-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76908900 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 3-[3-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]phenyl]prop-2-enoic acid |
| SMILES | Nc1cc(N)nc(SCc2cccc(C=CC(=O)O)c2)n1 |
| InChI | InChI=1S/C14H14N4O2S/c15-11-7-12(16)18-14(17-11)21-8-10-3-1-2-9(6-10)4-5-13(19)20/h1-7H,8H2,(H,19,20)(H4,15,16,17,18) |
| InChIKey | KNYNQZJUISQLHP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 115.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|