C13H16O2S — CID 109375695
(E)-3-[3-(propan-2-ylsulfanylmethyl)phenyl]prop-2-enoic acid (PubChem CID 109375695) has the molecular formula C13H16O2S and a molecular weight of 236.34 g/mol. Its IUPAC name is (E)-3-[3-(propan-2-ylsulfanylmethyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-(propan-2-ylsulfanylmethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 109375695 |
| Molecular Formula | C13H16O2S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | (E)-3-[3-(propan-2-ylsulfanylmethyl)phenyl]prop-2-enoic acid |
| SMILES | CC(C)SCc1cccc(/C=C/C(=O)O)c1 |
| InChI | InChI=1S/C13H16O2S/c1-10(2)16-9-12-5-3-4-11(8-12)6-7-13(14)15/h3-8,10H,9H2,1-2H3,(H,14,15)/b7-6+ |
| InChIKey | XXAUNNAGWRFDPI-VOTSOKGWSA-N |
| XLogP | 3.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|