C14H14N2O2S — CID 109375641
(E)-3-[3-[(1-methylimidazol-2-yl)sulfanylmethyl]phenyl]prop-2-enoic acid (PubChem CID 109375641) has the molecular formula C14H14N2O2S and a molecular weight of 274.35 g/mol. Its IUPAC name is (E)-3-[3-[(1-methylimidazol-2-yl)sulfanylmethyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[(1-methylimidazol-2-yl)sulfanylmethyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 109375641 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | (E)-3-[3-[(1-methylimidazol-2-yl)sulfanylmethyl]phenyl]prop-2-enoic acid |
| SMILES | Cn1ccnc1SCc1cccc(/C=C/C(=O)O)c1 |
| InChI | InChI=1S/C14H14N2O2S/c1-16-8-7-15-14(16)19-10-12-4-2-3-11(9-12)5-6-13(17)18/h2-9H,10H2,1H3,(H,17,18)/b6-5+ |
| InChIKey | ROWFNTLFFQFJQU-AATRIKPKSA-N |
| XLogP | 2.81 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|