C18H23N3OS — CID 39074526
[3-[(1-methylimidazol-2-yl)sulfanylmethyl]phenyl]-(4-methylpiperidin-1-yl)methanone (PubChem CID 39074526) has the molecular formula C18H23N3OS and a molecular weight of 329.47 g/mol. Its IUPAC name is [3-[(1-methylimidazol-2-yl)sulfanylmethyl]phenyl]-(4-methylpiperidin-1-yl)methanone.
| Compound Name | [3-[(1-methylimidazol-2-yl)sulfanylmethyl]phenyl]-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 39074526 |
| Molecular Formula | C18H23N3OS |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | [3-[(1-methylimidazol-2-yl)sulfanylmethyl]phenyl]-(4-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCN(C(=O)c2cccc(CSc3nccn3C)c2)CC1 |
| InChI | InChI=1S/C18H23N3OS/c1-14-6-9-21(10-7-14)17(22)16-5-3-4-15(12-16)13-23-18-19-8-11-20(18)2/h3-5,8,11-12,14H,6-7,9-10,13H2,1-2H3 |
| InChIKey | IWCBXMZCVOIRLA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |