C12H11ClN4O2S — CID 102670281
3-chloro-4-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]benzoic acid (PubChem CID 102670281) has the molecular formula C12H11ClN4O2S and a molecular weight of 310.77 g/mol. Its IUPAC name is 3-chloro-4-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]benzoic acid.
| Compound Name | 3-chloro-4-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]benzoic acid |
|---|---|
| PubChem CID | 102670281 |
| Molecular Formula | C12H11ClN4O2S |
| Molecular Weight | 310.77 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 3-chloro-4-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CSc2nnnn2C2CC2)c(Cl)c1 |
| InChI | InChI=1S/C12H11ClN4O2S/c13-10-5-7(11(18)19)1-2-8(10)6-20-12-14-15-16-17(12)9-3-4-9/h1-2,5,9H,3-4,6H2,(H,18,19) |
| InChIKey | PZYPVQODMVWRKO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.77 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |