C12H13BrN6OS — CID 102774921
3-bromo-4-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]benzohydrazide (PubChem CID 102774921) has the molecular formula C12H13BrN6OS and a molecular weight of 369.25 g/mol. Its IUPAC name is 3-bromo-4-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]benzohydrazide.
| Compound Name | 3-bromo-4-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]benzohydrazide |
|---|---|
| PubChem CID | 102774921 |
| Molecular Formula | C12H13BrN6OS |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | 3-bromo-4-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]benzohydrazide |
| SMILES | NNC(=O)c1ccc(CSc2nnnn2C2CC2)c(Br)c1 |
| InChI | InChI=1S/C12H13BrN6OS/c13-10-5-7(11(20)15-14)1-2-8(10)6-21-12-16-17-18-19(12)9-3-4-9/h1-2,5,9H,3-4,6,14H2,(H,15,20) |
| InChIKey | DKICTNXXBPHCOA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|