C10H13BrN2O2S — CID 102774945
3-bromo-4-(2-hydroxyethylsulfanylmethyl)benzohydrazide (PubChem CID 102774945) has the molecular formula C10H13BrN2O2S and a molecular weight of 305.20 g/mol. Its IUPAC name is 3-bromo-4-(2-hydroxyethylsulfanylmethyl)benzohydrazide.
| Compound Name | 3-bromo-4-(2-hydroxyethylsulfanylmethyl)benzohydrazide |
|---|---|
| PubChem CID | 102774945 |
| Molecular Formula | C10H13BrN2O2S |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | 3-bromo-4-(2-hydroxyethylsulfanylmethyl)benzohydrazide |
| SMILES | NNC(=O)c1ccc(CSCCO)c(Br)c1 |
| InChI | InChI=1S/C10H13BrN2O2S/c11-9-5-7(10(15)13-12)1-2-8(9)6-16-4-3-14/h1-2,5,14H,3-4,6,12H2,(H,13,15) |
| InChIKey | DFGGEEDSFWBBHM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|