C10H11BrO3S — CID 102765720
3-bromo-4-(2-hydroxyethylsulfanylmethyl)benzoic acid (PubChem CID 102765720) has the molecular formula C10H11BrO3S and a molecular weight of 291.17 g/mol. Its IUPAC name is 3-bromo-4-(2-hydroxyethylsulfanylmethyl)benzoic acid.
| Compound Name | 3-bromo-4-(2-hydroxyethylsulfanylmethyl)benzoic acid |
|---|---|
| PubChem CID | 102765720 |
| Molecular Formula | C10H11BrO3S |
| Molecular Weight | 291.17 g/mol |
| Exact Mass | 289.96 |
| IUPAC Name | 3-bromo-4-(2-hydroxyethylsulfanylmethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(CSCCO)c(Br)c1 |
| InChI | InChI=1S/C10H11BrO3S/c11-9-5-7(10(13)14)1-2-8(9)6-15-4-3-12/h1-2,5,12H,3-4,6H2,(H,13,14) |
| InChIKey | XVANQQGDMAIGFK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.17 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|