C12H11BrN4O2S — CID 102774932
3-bromo-4-[(6-oxo-1H-pyrimidin-2-yl)sulfanylmethyl]benzohydrazide (PubChem CID 102774932) has the molecular formula C12H11BrN4O2S and a molecular weight of 355.22 g/mol. Its IUPAC name is 3-bromo-4-[(6-oxo-1H-pyrimidin-2-yl)sulfanylmethyl]benzohydrazide.
| Compound Name | 3-bromo-4-[(6-oxo-1H-pyrimidin-2-yl)sulfanylmethyl]benzohydrazide |
|---|---|
| PubChem CID | 102774932 |
| Molecular Formula | C12H11BrN4O2S |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | 3-bromo-4-[(6-oxo-1H-pyrimidin-2-yl)sulfanylmethyl]benzohydrazide |
| SMILES | NNC(=O)c1ccc(CSc2nccc(=O)[nH]2)c(Br)c1 |
| InChI | InChI=1S/C12H11BrN4O2S/c13-9-5-7(11(19)17-14)1-2-8(9)6-20-12-15-4-3-10(18)16-12/h1-5H,6,14H2,(H,17,19)(H,15,16,18) |
| InChIKey | VUTRLILIGHWWIA-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|