C13H13BrN4OS — CID 102774983
4-[(6-amino-3-pyridinyl)sulfanylmethyl]-3-bromobenzohydrazide (PubChem CID 102774983) has the molecular formula C13H13BrN4OS and a molecular weight of 353.25 g/mol. Its IUPAC name is 4-[(6-amino-3-pyridinyl)sulfanylmethyl]-3-bromobenzohydrazide.
| Compound Name | 4-[(6-amino-3-pyridinyl)sulfanylmethyl]-3-bromobenzohydrazide |
|---|---|
| PubChem CID | 102774983 |
| Molecular Formula | C13H13BrN4OS |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | 4-[(6-amino-3-pyridinyl)sulfanylmethyl]-3-bromobenzohydrazide |
| SMILES | NNC(=O)c1ccc(CSc2ccc(N)nc2)c(Br)c1 |
| InChI | InChI=1S/C13H13BrN4OS/c14-11-5-8(13(19)18-16)1-2-9(11)7-20-10-3-4-12(15)17-6-10/h1-6H,7,16H2,(H2,15,17)(H,18,19) |
| InChIKey | LRMOYIAVJIJBBA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|