C8H12N4OS — CID 63590449
3-[(6-amino-3-pyridinyl)sulfanyl]propanehydrazide (PubChem CID 63590449) has the molecular formula C8H12N4OS and a molecular weight of 212.28 g/mol. Its IUPAC name is 3-[(6-amino-3-pyridinyl)sulfanyl]propanehydrazide.
| Compound Name | 3-[(6-amino-3-pyridinyl)sulfanyl]propanehydrazide |
|---|---|
| PubChem CID | 63590449 |
| Molecular Formula | C8H12N4OS |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 3-[(6-amino-3-pyridinyl)sulfanyl]propanehydrazide |
| SMILES | NNC(=O)CCSc1ccc(N)nc1 |
| InChI | InChI=1S/C8H12N4OS/c9-7-2-1-6(5-11-7)14-4-3-8(13)12-10/h1-2,5H,3-4,10H2,(H2,9,11)(H,12,13) |
| InChIKey | PSDKCMMMNXLCHR-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|