C9H15N3S — CID 106318328
5-[3-(methylamino)propylsulfanyl]pyridin-2-amine (PubChem CID 106318328) has the molecular formula C9H15N3S and a molecular weight of 197.31 g/mol. Its IUPAC name is 5-[3-(methylamino)propylsulfanyl]pyridin-2-amine.
| Compound Name | 5-[3-(methylamino)propylsulfanyl]pyridin-2-amine |
|---|---|
| PubChem CID | 106318328 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 5-[3-(methylamino)propylsulfanyl]pyridin-2-amine |
| SMILES | CNCCCSc1ccc(N)nc1 |
| InChI | InChI=1S/C9H15N3S/c1-11-5-2-6-13-8-3-4-9(10)12-7-8/h3-4,7,11H,2,5-6H2,1H3,(H2,10,12) |
| InChIKey | KNWVWUMZVXJHSS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|