C10H17N3S — CID 82095718
5-[3-(dimethylamino)propylsulfanyl]pyridin-2-amine (PubChem CID 82095718) has the molecular formula C10H17N3S and a molecular weight of 211.33 g/mol. Its IUPAC name is 5-[3-(dimethylamino)propylsulfanyl]pyridin-2-amine.
| Compound Name | 5-[3-(dimethylamino)propylsulfanyl]pyridin-2-amine |
|---|---|
| PubChem CID | 82095718 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 5-[3-(dimethylamino)propylsulfanyl]pyridin-2-amine |
| SMILES | CN(C)CCCSc1ccc(N)nc1 |
| InChI | InChI=1S/C10H17N3S/c1-13(2)6-3-7-14-9-4-5-10(11)12-8-9/h4-5,8H,3,6-7H2,1-2H3,(H2,11,12) |
| InChIKey | HFTCNPZUNIMSMK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|