C10H13F2NS — CID 61385791
3-(3,4-difluorophenyl)sulfanyl-N-methylpropan-1-amine (PubChem CID 61385791) has the molecular formula C10H13F2NS and a molecular weight of 217.28 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)sulfanyl-N-methylpropan-1-amine.
| Compound Name | 3-(3,4-difluorophenyl)sulfanyl-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 61385791 |
| Molecular Formula | C10H13F2NS |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 3-(3,4-difluorophenyl)sulfanyl-N-methylpropan-1-amine |
| SMILES | CNCCCSc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H13F2NS/c1-13-5-2-6-14-8-3-4-9(11)10(12)7-8/h3-4,7,13H,2,5-6H2,1H3 |
| InChIKey | JOBATKPEJXTKBC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|