C16H14F2OS — CID 43224909
4-(3,4-difluorophenyl)sulfanyl-1-phenylbutan-1-one (PubChem CID 43224909) has the molecular formula C16H14F2OS and a molecular weight of 292.35 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)sulfanyl-1-phenylbutan-1-one.
| Compound Name | 4-(3,4-difluorophenyl)sulfanyl-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 43224909 |
| Molecular Formula | C16H14F2OS |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 4-(3,4-difluorophenyl)sulfanyl-1-phenylbutan-1-one |
| SMILES | O=C(CCCSc1ccc(F)c(F)c1)c1ccccc1 |
| InChI | InChI=1S/C16H14F2OS/c17-14-9-8-13(11-15(14)18)20-10-4-7-16(19)12-5-2-1-3-6-12/h1-3,5-6,8-9,11H,4,7,10H2 |
| InChIKey | RDWSHXJZSQLFIM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|